CAS 1614-73-9
:cyclohept-4-ene-1-carboxylic acid
Description:
Cyclohept-4-ene-1-carboxylic acid is a cyclic unsaturated carboxylic acid characterized by a seven-membered carbon ring with a double bond at the fourth position and a carboxylic acid functional group at the first position. Its molecular structure features a combination of sp² and sp³ hybridized carbon atoms, contributing to its unique reactivity and physical properties. The presence of the double bond introduces geometric isomerism, while the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and decarboxylation. Cyclohept-4-ene-1-carboxylic acid is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in polar solvents like water and alcohols, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Its reactivity and structural features make it of interest in the fields of organic chemistry and materials science. Safety precautions should be taken when handling this compound, as with many organic acids.
Formula:C8H12O2
InChI:InChI=1/C8H12O2/c9-8(10)7-5-3-1-2-4-6-7/h1-2,7H,3-6H2,(H,9,10)
SMILES:C1=CCCC(CC1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Cycloheptene-1-carboxylicacid
CAS:Formula:C8H12O2Purity:97%Color and Shape:SolidMolecular weight:140.1797Cyclohept-4-enecarboxylic acid
CAS:Cyclohept-4-enecarboxylic acidPurity:95%Molecular weight:140.18g/molCyclohept-4-enecarboxylic acid
CAS:Cyclohept-4-enecarboxylic acid is a cyclic ketone that has been shown to yield monoaldehydes and bicyclic β-unsaturated ketones when subjected to thermodynamic equilibration. It can be synthesized from the dienone by aldol cyclization, or by the intramolecular reaction of an enamine with itself. Cycloheptenes are analogous compounds to this ketone.Formula:C8H12O2Purity:Min. 95%Molecular weight:140.18 g/mol
