CAS 161401-82-7: N-[(benzyloxy)carbonyl]-L-valyl-N-[(1S)-1-(carboxymethyl)-3-fluoro-2-oxopropyl]-L-alaninamide
Description:N-[(benzyloxy)carbonyl]-L-valyl-N-[(1S)-1-(carboxymethyl)-3-fluoro-2-oxopropyl]-L-alaninamide, with CAS number 161401-82-7, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a complex structure characterized by the presence of a benzyloxycarbonyl group, which is a common protective group in peptide synthesis, and two amino acid residues: L-valine and L-alanine. The compound also contains a unique side chain with a carboxymethyl group and a fluorinated moiety, which may impart specific biological activities or enhance its pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of peptide-based therapeutics. The presence of fluorine can influence the compound's lipophilicity and metabolic stability. As with many synthetic peptides, the solubility, stability, and reactivity of this compound can vary based on environmental conditions, making it important for researchers to consider these factors during experimentation and application.
Formula:C21H28FN3O7
InChI:InChI=1/C21H28FN3O7/c1-12(2)18(25-21(31)32-11-14-7-5-4-6-8-14)20(30)23-13(3)19(29)24-15(9-17(27)28)16(26)10-22/h4-8,12-13,15,18H,9-11H2,1-3H3,(H,23,30)(H,24,29)(H,25,31)(H,27,28)/t13-,15-,18-/m0/s1
- Synonyms:
- L-alaninamide, N-[(phenylmethoxy)carbonyl]-L-valyl-N-[(1S)-1-(carboxymethyl)-3-fluoro-2-oxopropyl]-
- N-[(benzyloxy)carbonyl]-L-valyl-N-[(2S)-1-carboxy-4-fluoro-3-oxobutan-2-yl]-L-alaninamide