CAS 161417-28-3
:4-Bromo-3-pyridinol
Description:
4-Bromo-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a hydroxyl group at the 3-position contributes to its unique chemical properties. This compound is typically a pale yellow to brown solid and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. It exhibits moderate stability under standard conditions but may undergo reactions typical of both aromatic compounds and alcohols, such as electrophilic substitution and oxidation. 4-Bromo-3-pyridinol is of interest in medicinal chemistry and may serve as a building block for the synthesis of various pharmaceuticals or agrochemicals. Its reactivity and functional groups allow for further derivatization, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C5H4BrNO
InChI:InChI=1/C5H4BrNO/c6-4-1-2-7-3-5(4)8/h1-3,8H
SMILES:c1cncc(c1Br)O
Synonyms:- 4-Bromo-3-hydroxypyridine
- 4-Bromopyridin-3-Ol
- 4-Boro-3-Hydroxypyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA001SGD
1g32.00€5g79.00€10g128.00€1kgTo inquire25g213.00€50g558.00€100gTo inquire500gTo inquire100mg21.00€250mg25.00€4-Bromo-3-hydroxypyridine
CAS:4-Bromo-3-hydroxypyridineFormula:C5H4BrNOPurity:98%Color and Shape: light yellow solidMolecular weight:174.00g/mol4-Bromo-3-hydroxypyridine
CAS:Formula:C5H4BrNOPurity:96%Color and Shape:SolidMolecular weight:173.9974-Bromo-3-hydroxypyridine
CAS:Controlled ProductApplications 4-Bromo-3-hydroxypyridine (cas# 161417-28-3) is a compound useful in organic synthesis.
Formula:C5H4BrNOColor and Shape:NeatMolecular weight:174.004-Bromo-3-hydroxypyridine
CAS:4-Bromo-3-hydroxypyridine is an organic compound that is a pyrrole derivative. It can be synthesized by the reaction of 3-bromo-5-hydroxypyridine with 2-amino-4-hydroxypyridine and acrylonitrile. The substitutions on the 4 position, 2 positions, and 1 position are all possible. This compound is used as a reagent for aminations and as a building block in the synthesis of substituted piperidides.Formula:C5H4BrNOPurity:Min. 95%Molecular weight:174 g/mol




