CAS 161436-14-2
:4-[(E)-3-fluoroprop-2-enyl]-1,2-dimethoxy-benzene
Description:
4-[(E)-3-fluoroprop-2-enyl]-1,2-dimethoxy-benzene, with the CAS number 161436-14-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methoxy groups and a fluoropropenyl side chain. The presence of the methoxy groups contributes to its potential as a versatile building block in organic synthesis, influencing its reactivity and solubility. The fluorine atom in the side chain can enhance the compound's biological activity and lipophilicity, making it of interest in medicinal chemistry. The (E)-configuration of the prop-2-enyl group indicates a specific geometric arrangement that can affect the compound's interactions in biological systems. This compound may exhibit unique physical properties, such as specific melting and boiling points, and its reactivity can be influenced by the electron-donating nature of the methoxy groups and the electron-withdrawing effect of the fluorine atom. Overall, this compound's structural features suggest potential applications in pharmaceuticals and materials science.
Formula:C11H13FO2
InChI:InChI=1/C11H13FO2/c1-13-10-6-5-9(4-3-7-12)8-11(10)14-2/h3,5-8H,4H2,1-2H3/b7-3+
Synonyms:- Z-1,2-Dimethoxy-4-(3-fluoro-2-propenyl)benzene
- 4-[(2E)-3-fluoroprop-2-en-1-yl]-1,2-dimethoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzene, 4-[(2Z)-3-fluoro-2-propen-1-yl]-1,2-dimethoxy-
CAS:Formula:C11H13FO2Molecular weight:196.2181Z-1,2-Dimethoxy-4-(3-fluoro-2-propenyl)benzene
CAS:Z-1,2-Dimethoxy-4-(3-fluoro-2-propenyl)benzene is the fluorine analog of Methyl eugenol (ME), the attractant of the oriental fruit fly B.Formula:C11H13FO2Color and Shape:SolidMolecular weight:196.22

