CAS 161479-51-2

D-Isoleucine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl-

Description:

D-Isoleucine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- is a derivative of the amino acid isoleucine, characterized by the presence of a protective group, specifically a tert-butoxycarbonyl (Boc) group. This modification enhances its stability and solubility, making it suitable for various applications in peptide synthesis and pharmaceutical development. The compound features a branched aliphatic side chain, which contributes to its hydrophobic properties, influencing its interactions in biological systems. As a chiral molecule, it exists in two enantiomeric forms, with D-Isoleucine being one of them, which can have different biological activities. The presence of the Boc group allows for selective reactions in synthetic pathways, facilitating the formation of peptides. Additionally, the compound's molecular structure includes a methyl group at the 3-position, which can affect its steric and electronic properties. Overall, D-Isoleucine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- is significant in the context of organic synthesis and biochemistry, particularly in the design of bioactive compounds.

Formula: C₁₂H₂₃NO₄

InChI: InChI=1S/C12H23NO4/c1-7-12(5,6)8(9(14)15)13-10(16)17-11(2,3)4/h8H,7H2,1-6H3,(H,13,16)(H,14,15)/t8-/m0/s1

InChI key: InChIKey=WZKPSAWKRJWANR-QMMMGPOBSA-N

SMILES: [C@@H](NC(OC(C)(C)C)=O)([C@@](CC)(C)C)C(O)=O

Synonyms:

• D-Isoleucine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl-
• (2R)-2-[[(tert-Butoxy)carbonyl]amino]-3,3-dimethylpentanoic acid

Boc-D-a-tert-amylglycine

CAS: 161479-51-2

Formula: C₁₂H₂₃NO₄

Purity: 98.0%

Molecular weight: 245.319

Ref: 10-F494288