CAS 16148-06-4
:1,3-Dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-2H-benzimidazol-2-one
Description:
1,3-Dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-2H-benzimidazol-2-one, with CAS number 16148-06-4, is a chemical compound characterized by its complex structure, which includes a benzimidazole core fused with a piperidine ring. This compound typically exhibits properties associated with both the benzimidazole and piperidine moieties, such as potential biological activity, including analgesic or anti-inflammatory effects. It is often studied for its pharmacological applications, particularly in the context of central nervous system activity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its ability to cross biological membranes. Additionally, the compound may exhibit specific solubility characteristics, stability under various conditions, and reactivity with other chemical species, making it of interest in medicinal chemistry and drug development. Safety and handling precautions are essential when working with this compound, as with many organic chemicals, due to potential toxicity or reactivity.
Formula:C19H21N3O
InChI:InChI=1S/C19H21N3O/c23-19-20-17-8-4-5-9-18(17)22(19)16-10-12-21(13-11-16)14-15-6-2-1-3-7-15/h1-9,16H,10-14H2,(H,20,23)
InChI key:InChIKey=WMPRRSYNQDCNCE-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(N1)=CC=CC2)C3CCN(CC4=CC=CC=C4)CC3
Synonyms:- 1,3-Dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-2H-benzimidazol-2-one
- 1-(1-benzylpiperidin-4-yl)-1,3-dihydro-2H-benzimidazol-2-one
- 1-benzyl-4-(piperidin-1-yl)-1,3-dihydro-2H-benzimidazol-2-one
- 2-Benzimidazolinone, 1-(1-benzyl-4-piperidyl)-
- 2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-
- 3-(1-Benzylpiperidin-4-yl)-1H-benzimidazol-2-one
- NSC 78484
- R 4782
- 1,3-Dihydro-1-(1-benzyl-4-piperidinyl)-2H-benzimidazol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
2H-Benzimidazol-2-one, 1,3-dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-
CAS:Formula:C19H21N3OColor and Shape:SolidMolecular weight:307.38951,3-Dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-2H-benzimidazol-2-one-d5
CAS:Controlled ProductApplications 1,3-Dihydro-1-[1-(phenylmethyl)-4-piperidinyl]-2H-benzimidazol-2-one-d5 is an isotope labelled intermediate in the synthesis of Pimozide (D453302), a D2 dopamine receptor antagonist.
Formula:C19H16D5N3OColor and Shape:NeatMolecular weight:312.42



