CymitQuimica logo

CAS 161510-48-1

:

benzyl [(2S)-4-amino-1-{[(2S,3R,4R)-4-(benzylamino)-5-{[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino}-3-hydroxy-5-oxo-1-phenylpentan-2-yl]amino}-1,4-dioxobutan-2-yl]carbamate (non-preferred name)

Description:
Benzyl [(2S)-4-amino-1-{[(2S,3R,4R)-4-(benzylamino)-5-{[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino}-3-hydroxy-5-oxo-1-phenylpentan-2-yl]amino}-1,4-dioxobutan-2-yl]carbamate, with CAS number 161510-48-1, is a complex organic compound characterized by its multi-functional structure, which includes multiple amino groups and a carbamate moiety. This compound is likely to exhibit properties typical of amino acids and peptides, such as solubility in polar solvents and potential biological activity. Its structure suggests it may participate in hydrogen bonding due to the presence of hydroxyl and amino groups, influencing its reactivity and interaction with biological systems. The presence of multiple aromatic rings indicates potential for π-π stacking interactions, which can affect its stability and binding affinity in biochemical contexts. Overall, this compound's intricate structure may contribute to its potential applications in pharmaceuticals or biochemistry, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C42H50N6O7
InChI:InChI=1/C42H50N6O7/c1-28(2)36(40(52)45-26-31-19-11-5-12-20-31)48-41(53)37(44-25-30-17-9-4-10-18-30)38(50)33(23-29-15-7-3-8-16-29)46-39(51)34(24-35(43)49)47-42(54)55-27-32-21-13-6-14-22-32/h3-22,28,33-34,36-38,44,50H,23-27H2,1-2H3,(H2,43,49)(H,45,52)(H,46,51)(H,47,54)(H,48,53)/t33-,34-,36-,37+,38+/m0/s1
Synonyms:
  • benzyl [(2S)-4-amino-1-{[(2S,3R,4R)-4-(benzylamino)-5-{[(2S)-1-(benzylamino)-3-methyl-1-oxobutan-2-yl]amino}-3-hydroxy-5-oxo-1-phenylpentan-2-yl]amino}-1,4-dioxobutan-2-yl]carbamate (non-preferred name)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.