CymitQuimica logo

CAS 161511-90-6

:

(R)-1-(TERT-BUTOXYCARBONYL)-2-AZETIDINEMETHANOL

Description:
(R)-1-(tert-Butoxycarbonyl)-2-azetidinemethanol is a chiral compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amine, enhancing the compound's stability and facilitating further chemical reactions. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals, due to its ability to serve as a building block for more complex molecules. The presence of the hydroxymethyl group contributes to its reactivity, allowing for various functionalization reactions. Its chirality indicates that it can exist in two enantiomeric forms, which can exhibit different biological activities. The compound's physical properties, such as solubility and melting point, can vary based on the solvent and conditions used. Overall, (R)-1-(tert-Butoxycarbonyl)-2-azetidinemethanol is significant in medicinal chemistry and synthetic organic chemistry for its versatile applications.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(10)6-11/h7,11H,4-6H2,1-3H3/t7-/m1/s1
InChI key:XIRUXUKRGUFEKC-SSDOTTSWSA-N
SMILES:CC(C)(C)OC(=O)N1CC[C@@H]1CO
Synonyms:
  • (R)-2-Hydroxymethyl-Azetidine-1-Carboxylic Acid Tert-Butyl Ester
  • (R)-1-Boc-2-Azetidinemethanol
  • tert-butyl (2R)-2-(hydroxymethyl)azetidine-1-carboxylate
Found 5 products.