CymitQuimica logo

CAS 16152-51-5

:

4-Isopropylbenzeneboronic acid

Description:
4-Isopropylbenzeneboronic acid, with the CAS number 16152-51-5, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a para-substituted isopropylbenzene ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of boronic acids, including the ability to form reversible complexes with diols, which makes it useful in various applications such as organic synthesis and medicinal chemistry. The isopropyl group contributes to its hydrophobic character, influencing its reactivity and solubility. Additionally, 4-isopropylbenzeneboronic acid can participate in Suzuki-Miyaura cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Its boronic acid functionality also allows for potential applications in drug development and materials science, particularly in the design of sensors and catalysts. Overall, this compound is significant in both academic research and industrial applications due to its versatile reactivity and functional properties.
Formula:C9H13BO2
InChI:InChI=1/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3
InChI key:IAEUFBDMVKQCLU-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(cc1)B(O)O
Synonyms:
  • 4-Cumylboronic acid
  • [4-(1-Methylethyl)Phenyl]Boronic Acid
  • 4-Isopropylphenylboronic acid
  • 4-Isoprophenylboronic Acid
Found 7 products.