CAS 161532-56-5
:4-[4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)tetrahydrofuran-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1H-1,2,4-triazol-5-one
Description:
The chemical substance with the name "4-[4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)tetrahydrofuran-3-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1H-1,2,4-triazol-5-one" and CAS number "161532-56-5" is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups, including triazole and piperazine moieties. This compound exhibits potential pharmacological properties, often investigated for its role in medicinal chemistry, particularly in the development of antifungal agents. Its structure suggests a high degree of molecular complexity, which may influence its solubility, stability, and biological activity. The presence of difluorophenyl and tetrahydrofuran groups indicates potential interactions with biological targets, making it a subject of interest in drug design. Additionally, the compound's stereochemistry, particularly the (3R,5R) configuration, may play a crucial role in its pharmacodynamics and pharmacokinetics. Overall, this substance represents a significant example of the intricate relationships between molecular structure and biological function in pharmaceutical chemistry.
Formula:C32H32F2N8O3
InChI:InChI=1/C32H32F2N8O3/c33-24-1-10-29(30(34)15-24)32(19-41-21-35-20-37-41)16-23(18-45-32)17-44-28-8-6-26(7-9-28)40-13-11-39(12-14-40)25-2-4-27(5-3-25)42-22-36-38-31(42)43/h1-10,15,20-23H,11-14,16-19H2,(H,38,43)/t23-,32+/m1/s1
Synonyms:- Posaconazole inter-8
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Posaconazole Impurity 43
CAS:Formula:C32H32F2N8O3Color and Shape:Off-White SolidMolecular weight:614.66Deshydroxypentanyl Posaconazole
CAS:Controlled ProductFormula:C32H32F2N8O3Color and Shape:NeatMolecular weight:614.65Deshydroxypentanyl posaconazole
CAS:<p>Deshydroxypentanyl Posaconazole is a synthetic compound with an analytical standard available. It is a niche API that is not currently in use as a drug product. It is also an impurity standard for the HPLC and GC-MS analysis of deshydroxyphenyl fentanyl. Deshydroxypentanyl Posaconazole has been synthesized using the chemical reaction between desoxyphenyl fentanyl and posaconazole, which yields the desired product. The chemical structure of Deshydroxypentanyl Posaconazole can be found in CAS No. 161532-56-5.</p>Formula:C32H32F2N8O3Purity:Min. 95%Molecular weight:614.60 g/mol



