CymitQuimica logo

CAS 16154-71-5

:

2-METHYL-4-(4-METHYLPIPERAZIN-1-YL)ANILINE

Description:
2-Methyl-4-(4-methylpiperazin-1-yl)aniline, with the CAS number 16154-71-5, is an organic compound characterized by its aromatic amine structure. It features a methyl group and a piperazine ring, which contributes to its potential biological activity. The presence of the aniline moiety suggests that it may participate in hydrogen bonding and exhibit basic properties due to the amino group. This compound is typically a solid at room temperature and may have moderate solubility in polar solvents, influenced by the piperazine substituent. Its structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are often explored for their therapeutic properties. Additionally, the compound's characteristics, such as melting point, boiling point, and reactivity, would be influenced by the specific functional groups present and their spatial arrangement. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H20N3
InChI:InChI=1/C12H19N3/c1-10-9-11(3-4-12(10)13)15-7-5-14(2)6-8-15/h3-4,9H,5-8,13H2,1-2H3/p+1
InChI key:DTEFRDRZJUCTLM-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)N2CCN(CC2)C)N
Synonyms:
  • 4-(4-Amino-3-Methylphenyl)-1-Methylpiperazin-1-Ium
Found 3 products.