CAS 16156-56-2
:Methanesulfonic acid, cyclohexyl ester
Description:
Methanesulfonic acid, cyclohexyl ester, also known as cyclohexyl methanesulfonate, is an organic compound characterized by its ester functional group derived from methanesulfonic acid and cyclohexanol. It typically appears as a colorless to pale yellow liquid with a distinctive odor. This compound is soluble in organic solvents and exhibits moderate stability under standard conditions. Methanesulfonic acid esters are known for their utility in various chemical reactions, particularly as intermediates in organic synthesis and as solvents in certain applications. The presence of the methanesulfonate group imparts unique properties, such as enhanced reactivity and the ability to participate in nucleophilic substitution reactions. Additionally, cyclohexyl methanesulfonate may exhibit low toxicity, making it suitable for use in various industrial applications, including pharmaceuticals and agrochemicals. However, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C7H14O3S
InChI:InChI=1S/C7H14O3S/c1-11(8,9)10-7-5-3-2-4-6-7/h7H,2-6H2,1H3
InChI key:InChIKey=KOGOBKOHQTZGIS-UHFFFAOYSA-N
SMILES:O(S(C)(=O)=O)C1CCCCC1
Synonyms:- Cyclohexanyl methanesulfonate
- Cyclohexyl mesylate
- Cyclohexyl methanesulfonate
- Methanesulfonic acid, cyclohexyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methanesulfonic acid, cyclohexyl ester
CAS:Formula:C7H14O3SPurity:97%Color and Shape:LiquidMolecular weight:178.2493Cyclohexyl methanesulfonate
CAS:<p>Cyclohexyl methanesulfonate is a synthetic compound that acts as an inhibitor of the CCR5 receptor. It blocks the binding of HIV-1 to cells and prevents infection. Cyclohexyl methanesulfonate has been shown to be effective in preventing inflammatory diseases, such as Crohn's disease, and autoimmune diseases such as type 1 diabetes mellitus. Cyclohexyl methanesulfonate is a low-energy radical that can be synthesized using hydrochloric acid or sodium carbonate in the presence of trifluoroacetic acid. The synthesis requires a hydroxybenzoic acid and a trifluoromethanesulfonic acid for the formation of cyclohexane.</p>Formula:C7H14O3SPurity:Min. 95%Molecular weight:178.25 g/mol
