CAS 16156-94-8

2-[2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethoxy]ethanol

Description:

2-[2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethoxy]ethanol, with the CAS number 16156-94-8, is a chemical compound characterized by its imidazole ring, which contributes to its biological activity. This substance features a two-ethoxy group that enhances its solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of a nitro group on the imidazole ring indicates potential reactivity and biological significance, often associated with antimicrobial properties. The methyl group attached to the imidazole ring can influence the compound's lipophilicity and overall pharmacokinetics. Additionally, the hydroxyl group in the ethanol moiety can participate in hydrogen bonding, affecting the compound's interactions with biological targets. Overall, this compound's unique structure suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific safety and handling guidelines should be followed due to the presence of the nitro group, which can pose risks under certain conditions.

Formula: C₈H₁₃N₃O₄

InChI: InChI=1/C8H13N3O4/c1-7-9-6-8(11(13)14)10(7)2-4-15-5-3-12/h6,12H,2-5H2,1H3

SMILES: Cc1ncc(n1CCOCCO)N(=O)=O

Metronidazole EP Impurity F

CAS: 16156-94-8

Formula: C₈H₁₃N₃O₄

Color and Shape: Yellow Solid

Molecular weight: 215.21

Ref: 4Z-M-635

Metronidazole EP Impurity F

Controlled Product

CAS: 16156-94-8

Formula: C₈H₁₃N₃O₄

Color and Shape: Neat

Molecular weight: 215.21

Ref: 86-MM0012.08

Metronidazole EP impurity F

CAS: 16156-94-8

Formula: C₈H₁₃N₃O₄

Molecular weight: 215.21

Ref: ST-EA-CP-M18006

O-Hydroxyethyl Metronidazole

Controlled Product

CAS: 16156-94-8

Applications O-Hydroxyethyl Metronidazole is the hydroxy ethyl analogue and impurity of the antiprotozoal agent Metronidazole (M338880). O-Hydroxyethyl Metronidazole as well as other 1-substituted-2-methyl-5-nitroimidazoles showed potential antitrichomonal activity.
References Kajfez, F. et al.: J. Med. Chem., 11, 167 (1968);

Formula: C₈H₁₃N₃O₄

Color and Shape: Yellowish Solid

Molecular weight: 215.21

Ref: TR-H942280

o-Hydroxyethyl metronidazole

CAS: 16156-94-8

o-Hydroxyethyl metronidazole is an antibiotic that is used to treat infections caused by bacteria. It is a prodrug that undergoes hydrolysis in vivo to form the active compound, metronidazole. Metronidazole binds to bacterial DNA and inhibits the synthesis of proteins, leading to death of the cell. o-Hydroxyethyl metronidazole can be used for the treatment of anaerobic infections and infections caused by aerobic bacteria. The drug has been shown to be effective in treating infections of the colon, but not those of the urinary tract or respiratory tract.

Formula: C₈H₁₃N₃O₄

Purity: Min. 95%

Molecular weight: 215.21 g/mol

Ref: 3D-RAA15694