CAS 161609-79-6

4-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine

Description:

4-(5-methyl-1,3,4-oxadiazol-2-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a 1,3,4-oxadiazole moiety. The piperidine portion contributes to its cyclic amine properties, while the oxadiazole ring introduces heteroatoms, enhancing its potential for biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen and oxygen atoms in its structure. The presence of the methyl group on the oxadiazole ring can influence its electronic properties and reactivity. Compounds like this are often studied for their pharmacological properties, including potential applications in medicinal chemistry, as they may exhibit antimicrobial, anti-inflammatory, or other therapeutic effects. Additionally, the specific arrangement of atoms and functional groups can affect its interaction with biological targets, making it a subject of interest in drug design and development.

Formula: C₈H₁₃N₃O

InChI: InChI=1/C8H13N3O/c1-6-10-11-8(12-6)7-2-4-9-5-3-7/h7,9H,2-5H2,1H3

SMILES: Cc1nnc(C2CCNCC2)o1

Synonyms:

• Piperidine, 4-(5-Methyl-1,3,4-Oxadiazol-2-Yl)-

Piperidine, 4-(5-methyl-1,3,4-oxadiazol-2-yl)-

CAS: 161609-79-6

Formula: C₈H₁₃N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.2083

Ref: IN-DA001VQP

2-Methyl-5-(piperidin-4-yl)-1,3,4-oxadiazole

CAS: 161609-79-6

Formula: C₈H₁₃N₃O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 167.212

Ref: 10-F219327

4-(5-Methyl-1,3,4-oxadiazol-2-yl)piperidine

CAS: 161609-79-6

Versatile small molecule scaffold

Formula: C₈H₁₃N₃O

Purity: Min. 95%

Molecular weight: 167.21 g/mol

Ref: 3D-LGA60979