CAS 161622-14-6
:4-BROMO-3-(TRIFLUOROMETHYL)BENZOIC ACID
Description:
4-Bromo-3-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring. The bromine substituent is located at the para position relative to the carboxylic acid group, while the trifluoromethyl group is positioned at the meta location. This compound exhibits properties typical of halogenated benzoic acids, including moderate solubility in organic solvents and potential reactivity due to the electron-withdrawing effects of both the bromine and trifluoromethyl groups. The trifluoromethyl group significantly enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of the carboxylic acid functional group allows for potential hydrogen bonding and reactivity in various chemical reactions, including esterification and amidation. Overall, 4-bromo-3-(trifluoromethyl)benzoic acid is a valuable compound in synthetic organic chemistry and materials science.
Formula:C8H4BrF3O2
InChI:InChI=1/C8H4BrF3O2/c9-6-2-1-4(7(13)14)3-5(6)8(10,11)12/h1-3H,(H,13,14)
SMILES:c1cc(c(cc1C(=O)O)C(F)(F)F)Br
Synonyms:- Benzoic Acid, 4-Bromo-3-(Trifluoromethyl)-
- Qvr De Cxfff [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-3-(trifluoromethyl)benzoic acid
CAS:4-Bromo-3-(trifluoromethyl)benzoic acidFormula:C8H4BrF3O2Purity:97%Molecular weight:269.024-Bromo-3-(trifluoromethyl)benzoic acid
CAS:4-Bromo-3-(trifluoromethyl)benzoic acidFormula:C8H4BrF3O2Purity:≥95%Color and Shape:Solid-PowderMolecular weight:269.01536Benzoic acid, 4-bromo-3-(trifluoromethyl)-
CAS:Formula:C8H4BrF3O2Purity:97%Color and Shape:SolidMolecular weight:269.01544-Bromo-3-(trifluoromethyl)benzoic Acid
CAS:Formula:C8H4BrF3O2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:269.024-Bromo-3-(trifluoromethyl)benzoic acid
CAS:4-Bromo-3-(trifluoromethyl)benzoic acid is a synthetic molecule that has been used for the synthesis of polymers. It is used in the production of polyketones and polyphenylene, which are monomers for the polymerization process. 4-Bromo-3-(trifluoromethyl)benzoic acid is also used as an electrophile in the acylation step of polycondensation reactions. The biphenylene structure can be synthesized by sequential or simultaneous addition of bromine to phenol with sodium hydroxide or potassium tetrachloroplatinate. This chemical compound can be made into two isomers: 3,4-dibromobenzene dicarboxylic acid and 3,4-dichlorobenzene dicarboxylic acid.Formula:C8H4BrF3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:269.02 g/mol4-Bromo-3-(trifluoromethyl)benzoic acid
CAS:Formula:C8H4BrF3O2Purity:98%Color and Shape:SolidMolecular weight:269.017





