
CAS 1616340-69-2
:Methyl 5-[[[(2,4-difluorophenyl)methyl]amino]carbonyl]-1-(2,2-dihydroxyethyl)-1,4-dihydro-3-methoxy-4-oxo-2-pyridinecarboxylate
Description:
Methyl 5-[[[(2,4-difluorophenyl)methyl]amino]carbonyl]-1-(2,2-dihydroxyethyl)-1,4-dihydro-3-methoxy-4-oxo-2-pyridinecarboxylate, identified by CAS number 1616340-69-2, is a complex organic compound characterized by its intricate molecular structure. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its potential biological activity. The presence of a methoxy group and a carbonyl group suggests that it may exhibit various reactivity patterns typical of esters and amides. The difluorophenyl moiety indicates potential lipophilicity, which can influence its pharmacokinetic properties. Additionally, the compound contains hydroxyl groups, which may enhance solubility in polar solvents and could play a role in hydrogen bonding interactions. Overall, this compound's unique combination of functional groups may confer specific biological activities, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to elucidate its precise properties and potential applications.
Formula:C18H18F2N2O7
InChI:InChI=1S/C18H18F2N2O7/c1-28-16-14(18(27)29-2)22(8-13(23)24)7-11(15(16)25)17(26)21-6-9-3-4-10(19)5-12(9)20/h3-5,7,13,23-24H,6,8H2,1-2H3,(H,21,26)
InChI key:InChIKey=ZALVPHROCCRSES-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N(CC(O)O)C=C(C(NCC2=C(F)C=C(F)C=C2)=O)C(=O)C1OC
Synonyms:- Methyl 5-[[[(2,4-difluorophenyl)methyl]amino]carbonyl]-1-(2,2-dihydroxyethyl)-1,4-dihydro-3-methoxy-4-oxo-2-pyridinecarboxylate
- 2-Pyridinecarboxylic acid, 5-[[[(2,4-difluorophenyl)methyl]amino]carbonyl]-1-(2,2-dihydroxyethyl)-1,4-dihydro-3-methoxy-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cabotegravir Impurity 9
CAS:Formula:C18H16F2N2O6C18H18F2N2O7Molecular weight:394.33 (aldehyde) 412.35 (hydrate)
