CAS 16165-68-7
:Diethyl 1-decylphosphonate
Description:
Diethyl 1-decylphosphonate, with the CAS number 16165-68-7, is an organophosphorus compound characterized by the presence of a phosphonate functional group. This substance typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It features a long hydrocarbon chain (decyl) which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. Diethyl 1-decylphosphonate is often utilized in various applications, including as a reagent in organic synthesis and as a potential intermediate in the production of phosphonate esters. Its chemical structure includes two ethyl groups attached to the phosphorus atom, which can influence its reactivity and interactions with other chemical species. Additionally, like many organophosphorus compounds, it may exhibit biological activity, necessitating careful handling and consideration of safety protocols in laboratory and industrial settings. Overall, its unique properties make it a compound of interest in both research and practical applications in chemistry.
Formula:C14H31O3P
InChI:InChI=1/C14H31O3P/c1-4-7-8-9-10-11-12-13-14-18(15,16-5-2)17-6-3/h4-14H2,1-3H3
SMILES:CCCCCCCCCCP(=O)(OCC)OCC
Synonyms:- 1-Decylphosphonic acid diethyl ester~Diethyl 1-decanephosphonate
- Diethyl Decylphosphonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Diethyl 1-decylphosphonate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H31O3PPurity:97%Color and Shape:Clear colorless, LiquidMolecular weight:278.37
