CymitQuimica logo

CAS 1616500-60-7

:

5-Fluoro-3-methoxy-2-pyridinemethanol

Description:
5-Fluoro-3-methoxy-2-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a methoxy group at the 3-position contributes to its unique reactivity and potential biological activity. The hydroxymethyl group at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of targeting specific receptors or enzymes. Its molecular structure suggests that it may exhibit properties such as antimicrobial or anti-inflammatory activity, although specific biological data would be required to confirm these effects. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C7H8FNO2
InChI:InChI=1S/C7H8FNO2/c1-11-7-2-5(8)3-9-6(7)4-10/h2-3,10H,4H2,1H3
InChI key:InChIKey=XBXDJFWLMNGEBT-UHFFFAOYSA-N
SMILES:C(O)C1=C(OC)C=C(F)C=N1
Synonyms:
  • 2-Pyridinemethanol, 5-fluoro-3-methoxy-
  • 5-Fluoro-3-methoxy-2-pyridinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.