CymitQuimica logo

CAS 1616526-82-9

:

4(3H)-Pyrimidinone, 5-hydroxy-, hydrochloride (1:1)

Description:
4(3H)-Pyrimidinone, 5-hydroxy-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidinone structure, which features a six-membered aromatic ring containing nitrogen atoms. The presence of a hydroxyl group at the 5-position enhances its solubility in polar solvents and may influence its biological activity. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often exhibiting improved solubility in aqueous solutions. This compound may be of interest in pharmaceutical research due to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular interactions, including hydrogen bonding and potential for tautomerism, can play a significant role in its reactivity and biological function. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 4(3H)-Pyrimidinone, 5-hydroxy-, hydrochloride (1:1) represents a versatile compound with potential utility in various chemical and biological applications.
Formula:C4H4N2O2·ClH
InChI:InChI=1S/C4H4N2O2.ClH/c7-3-1-5-2-6-4(3)8;/h1-2,7H,(H,5,6,8);1H
InChI key:InChIKey=LRJXOAASQIHMRM-UHFFFAOYSA-N
SMILES:OC=1C(=O)NC=NC1.Cl
Synonyms:
  • 4(3H)-Pyrimidinone, 5-hydroxy-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.