CAS 16166-22-6

Acetamide, N-4-pyrimidinyl- (8CI,9CI)

Description:

Acetamide, N-4-pyrimidinyl- is an organic compound characterized by the presence of a pyrimidine ring substituted with an acetamide group. Its molecular structure features a pyrimidine moiety, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions, and an acetamide functional group (-C(=O)NH2) attached to the 4-position of the pyrimidine. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amide group that can engage in hydrogen bonding. Acetamide derivatives are often studied for their biological activity, including potential applications in pharmaceuticals and agrochemicals. The compound's CAS number, 16166-22-6, allows for its identification in chemical databases, facilitating research and regulatory compliance. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample.

Formula: C₆H₇N₃O

InChI: InChI=1/C6H7N3O/c1-5(10)9-6-2-3-7-4-8-6/h2-4H,1H3,(H,7,8,9,10)

SMILES: CC(=Nc1ccncn1)O

Synonyms:

• N-(pyrimidin-4-yl)acetamide

Acetamide, N-4-pyrimidinyl- (8CI,9CI)

CAS: 16166-22-6

Formula: C₆H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.1393

Ref: IN-DA00ASJU

N-(Pyrimidin-4-yl)acetamide

CAS: 16166-22-6

N-(Pyrimidin-4-yl)acetamide

Purity: 98%

Molecular weight: 137.14g/mol

Ref: 54-OR1061919

N-(Pyrimidin-4-yl)acetamide

CAS: 16166-22-6

Purity: 98%

Molecular weight: 137.1419983

Ref: 10-F635371