
CAS 1617-23-8
:Ethyl 2-methyl-3-pentenoate
Description:
Ethyl 2-methyl-3-pentenoate, with the CAS number 1617-23-8, is an organic compound classified as an ester. It is characterized by its fruity odor, which is typical of many esters, making it useful in flavoring and fragrance applications. The molecular structure features a pentenoate backbone, indicating the presence of a double bond in the carbon chain, which contributes to its reactivity and potential for undergoing various chemical reactions, such as polymerization. Ethyl 2-methyl-3-pentenoate is typically a colorless to pale yellow liquid and is soluble in organic solvents, while being less soluble in water due to its hydrophobic nature. Its boiling point and density can vary, but it generally exhibits moderate volatility. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of other chemicals. Safety data indicates that, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes and should be used in well-ventilated areas.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c1-4-6-7(3)8(9)10-5-2/h4,6-7H,5H2,1-3H3
InChI key:InChIKey=HOWBPXBYCPKWBL-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C=CC)C
Synonyms:- Ethyl 2-methyl-3-pentenoate
- Ethyl oxanoate 369
- 3-Pentenoic acid, 2-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
