CAS 1617-49-8
:3,3′,4-Tri-O-methylellagic acid
Description:
3,3′,4-Tri-O-methylellagic acid is a naturally occurring polyphenolic compound derived from ellagic acid, which is found in various fruits and nuts. This compound is characterized by the presence of three methoxy groups (-OCH3) attached to the ellagic acid structure, enhancing its solubility and potentially its bioactivity. It exhibits antioxidant properties, which may contribute to its role in protecting cells from oxidative stress and inflammation. Additionally, 3,3′,4-Tri-O-methylellagic acid has been studied for its potential health benefits, including anti-cancer and anti-inflammatory effects, although further research is needed to fully understand its mechanisms of action. The compound is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry (MS) for its identification and quantification in various biological samples. Its stability and reactivity can be influenced by environmental factors, making it an interesting subject for further investigation in both food science and pharmacology.
Formula:C17H12O8
InChI:InChI=1/C17H12O8/c1-21-9-5-7-11-10-6(16(19)25-15(11)13(9)23-3)4-8(18)12(22-2)14(10)24-17(7)20/h4-5,18H,1-3H3
InChI key:InChIKey=LXEQIOGTMDLLEC-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C3C4=C(C(OC)=C(O)C=C4C(=O)O2)OC(=O)C3=CC1OC
Synonyms:- (1)Benzopyrano(5,4,3-cde)(1)benzopyran-5,10-dione, 2-hydroxy-3,7,8-trimethoxy-
- 2-Hydroxy-3,7,8-Trimethoxychromeno[5,4,3-Cde]Chromene-5,10-Dione
- 2-Hydroxy-3,7,8-trimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione
- 3,3',4-O-Trimethylellagic acid
- 3,3′,4-Tri-O-methylellagic acid
- 3,3′,4′-Trimethoxyellagic acid
- 3,4,3′-Tri-O-methylellagic acid
- Combretum caffrum
- Diphenic acid, 4,6,6′-trihydroxy-4′,5,5′-trimethoxy-, di-δ-lactone
- Ellagic Acid, 3,3',4-Tri-O-Methyl
- Ellagic acid 3,3′,4-trimethyl ether
- Nsc 333299
- 3,7,8-Tri-O-methylellagic acid
- 8-Tri-O-methylellagic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 2-hydroxy-3,7,8-trimethoxy-
CAS:Formula:C17H12O8Purity:97.0%Color and Shape:SolidMolecular weight:344.27242,3,8-Tri-O-methylellagic acid
CAS:2,3,8-tri-O-Methyl ellagic acid has antimicrobial activity agaist Vibro cholera, Staphylococcus aureus, Klebsiella pneumoniae, Pseudomonas aeruginosa, BacillusFormula:C17H12O8Purity:98%Color and Shape:SolidMolecular weight:344.272,3,8-Tri-o-methylellagic acid
CAS:2,3,8-Tri-o-methylellagic acid is a methoxy derivative of ellagic acid, which is a naturally occurring polyphenolic compound. It is primarily sourced from plants, particularly those belonging to the family of myrtles, rosaceae, and walnuts, where it acts as a secondary metabolite contributing to the plant's defense mechanisms.Formula:C17H12O8Purity:Min. 95%Molecular weight:344.3 g/mol



