CymitQuimica logo

CAS 161715-28-2

:

S-[1-(4,5-Dihydro-2-thiazolyl)-3-azetidinyl] ethanethioate

Description:
S-[1-(4,5-Dihydro-2-thiazolyl)-3-azetidinyl] ethanethioate, identified by its CAS number 161715-28-2, is a chemical compound characterized by its unique structural features, including a thiazole ring and an azetidine moiety. This compound typically exhibits properties associated with thiazole derivatives, such as potential biological activity, which may include antimicrobial or antifungal effects. The presence of the ethanethioate functional group suggests that it may participate in nucleophilic reactions, making it a candidate for various synthetic applications. Its molecular structure indicates that it may have specific stereochemical configurations, which can influence its reactivity and interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, S-[1-(4,5-Dihydro-2-thiazolyl)-3-azetidinyl] ethanethioate represents a class of compounds that may have significant implications in medicinal chemistry and pharmacology, warranting further investigation into its properties and potential applications.
Formula:C8H12N2OS2
InChI:InChI=1S/C8H12N2OS2/c1-6(11)13-7-4-10(5-7)8-9-2-3-12-8/h7H,2-5H2,1H3
InChI key:InChIKey=FOCHWRRZRMBNMV-UHFFFAOYSA-N
SMILES:S(C(C)=O)C1CN(C1)C2=NCCS2
Synonyms:
  • Ethanethioic acid, S-[1-(4,5-dihydro-2-thiazolyl)-3-azetidinyl] ester
  • 1-[[1-(4,5-Dihydro-1,3-thiazol-2-yl)azetidin-3-yl]sulfanyl]ethan-1-one
  • S-[1-(4,5-Dihydro-2-thiazolyl)-3-azetidinyl] ethanethioate
  • 3-Acetylthio-1-(1,3-thiazolin-2-yl)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.