CAS 16172-96-6

1-(3,5-BISTRIFLUOROMETHYLPHENYL)-PIPERAZINE

Description:

1-(3,5-Bis(trifluoromethyl)phenyl)-piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of the 3,5-bis(trifluoromethyl)phenyl group significantly influences its chemical properties, imparting high lipophilicity and potential biological activity. This compound is typically a solid at room temperature and is known for its stability under various conditions. Its trifluoromethyl groups enhance its electron-withdrawing characteristics, which can affect its reactivity and interactions with biological targets. The compound is often studied in medicinal chemistry for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Due to the presence of fluorine atoms, it may exhibit unique pharmacokinetic properties, such as improved metabolic stability. Safety and handling precautions are essential, as with many fluorinated compounds, due to potential toxicity and environmental concerns. Overall, 1-(3,5-bis(trifluoromethyl)phenyl)-piperazine is of interest in both research and industrial applications.

Formula: C₁₂H₁₂F₆N₂

InChI: InChI=1/C12H12F6N2/c13-11(14,15)8-5-9(12(16,17)18)7-10(6-8)20-3-1-19-2-4-20/h5-7,19H,1-4H2

SMILES: C1CN(CCN1)c1cc(cc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• 1-[3,5-Bis(trifluoromethyl)phenyl]piperazine 98%
• 1-[3,5-Bis(trifluoromethyl)phenyl]piperazine98%

Piperazine, 1-[3,5-bis(trifluoromethyl)phenyl]-

CAS: 16172-96-6

Formula: C₁₂H₁₂F₆N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 298.2275

Ref: IN-DA001VV2

1-[3,5-Bis(trifluoromethyl)phenyl]piperazine

Controlled Product

CAS: 16172-96-6

1-[3,5-Bis(trifluoromethyl)phenyl]piperazine is a biochemical that belongs to the class of amides. It has been shown to have cholesterolytic properties and can be used for the treatment of high cholesterol levels. 1-[3,5-Bis(trifluoromethyl)phenyl]piperazine inhibits monoacylglycerol lipase (MAGL), which is an enzyme involved in lipid metabolism. The inhibition of this enzyme leads to an increase in the concentration of free fatty acids, which are then accepted by other enzymes and used as cellular energy sources. The structure of 1-[3,5-bis(trifluoromethyl)phenyl]piperazine was elucidated by NMR spectroscopy and mass spectrometry. The molecule consists of a piperazine core with a bis(trifluoromethoxyphenyl) substitu

Formula: C₁₂H₁₂F₆N₂

Purity: Min. 95%

Molecular weight: 298.23 g/mol

Ref: 3D-FB88293