CAS 161748-46-5
:4,6,7,8-Tetramethoxy-3-dibenzofuranol
Description:
4,6,7,8-Tetramethoxy-3-dibenzofuranol is a complex organic compound characterized by its unique molecular structure, which includes a dibenzofuran core substituted with four methoxy groups and a hydroxyl group. This compound is typically classified as a polyphenolic compound, which may exhibit various biological activities due to its structural features. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The hydroxyl group can participate in hydrogen bonding, potentially affecting its physical properties, such as melting point and boiling point. Additionally, compounds like this may be of interest in medicinal chemistry for their potential antioxidant, anti-inflammatory, or anticancer properties. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through experimental studies. Overall, 4,6,7,8-Tetramethoxy-3-dibenzofuranol represents a fascinating subject for research in organic chemistry and pharmacology.
Formula:C16H16O6
InChI:InChI=1/C16H16O6/c1-18-11-7-9-8-5-6-10(17)14(19-2)12(8)22-13(9)16(21-4)15(11)20-3/h5-7,17H,1-4H3
InChI key:InChIKey=NUNJCHKNADZUSZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C=3C(O2)=C(OC)C(O)=CC3)=CC(OC)=C1OC
Synonyms:- β-Cotonefuran
- 3-Dibenzofuranol, 4,6,7,8-tetramethoxy-
- 4,6,7,8-Tetramethoxy-3-dibenzofuranol
- beta-cotonefuran
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
β-Cotonefuran
CAS:β-Cotonefuran is a dibenzofuran-type phytoalexin produced by plants in response to both biotic and abiotic stresses, and it is utilized in studies on Arabidopsis' response to salt stress.Formula:C16H16O6Color and Shape:SolidMolecular weight:304.295
