CAS 161771-76-2
:Dihydro-1H,3H,5H-pyrrolo[1,2-a]thiazolo[3,4-d]pyrazine-5,8,10(5aH,10aH)-trione
Description:
Dihydro-1H,3H,5H-pyrrolo[1,2-a]thiazolo[3,4-d]pyrazine-5,8,10(5aH,10aH)-trione, with CAS number 161771-76-2, is a heterocyclic compound characterized by its complex fused ring structure, which includes elements of both nitrogen and sulfur in its framework. This compound features a pyrrolo-thiazolo-pyrazine core, contributing to its unique chemical properties. It typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of multiple functional groups, including carbonyls, enhances its reactivity and potential for forming various derivatives. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in biological systems. Additionally, the compound's structural features may influence its interaction with biological targets, potentially leading to therapeutic effects. Overall, this substance represents a fascinating area of study within the realm of organic and medicinal chemistry, with implications for the development of novel pharmacological agents.
Formula:C9H10N2O3S
InChI:InChI=1S/C9H10N2O3S/c12-7-2-1-5-8(13)10-4-15-3-6(10)9(14)11(5)7/h5-6H,1-4H2
InChI key:InChIKey=HLWTZCIFAMNMKX-UHFFFAOYSA-N
SMILES:O=C1C2N(C(=O)C3N1CSC3)C(=O)CC2
Synonyms:- Dihydro-1H,3H,5H-pyrrolo[1,2-a]thiazolo[3,4-d]pyrazine-5,8,10(5aH,10aH)-trione
- 1H,3H,5H-Pyrrolo[1,2-a]thiazolo[3,4-d]pyrazine-5,8,10(5aH,10aH)-trione, dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Pidotimod Diketopiperazine
CAS:Controlled ProductApplications An impurity product of Pidotimod (P437650).
References Crimella, T. et al.: Arzneim.-Forsch., 44, 1405 (1994); Gu, C., et al.: Pharm. Res., 25, 979 (2008); Fliri, A., et al.: J. Med. Chem., 52, 8038 (2009); Giagulli, C., et al.: Int. Immunopharmacol., 9, 1366 (2009);Formula:C9H10N2O3SColor and Shape:NeatMolecular weight:226.252Pidotimod Diketopiperazine
CAS:Pidotimod Diketopiperazine is a test substance that is a phosphoric acid salt of pidotimod with a diketopiperazine group. Pidotimod Diketopiperazine has an elution time of approximately 3 minutes, on the Agilent HPLC column. It is soluble in water and has a pH of around 1.5-2.5. Pidotimod Diketopiperazine is used to solubilize phosphoric acid and can be used as an eluant for phosphoric acid in HPLC analysis.
Formula:C9H10N2O3SPurity:Min. 95%Molecular weight:226.25 g/mol

