CAS 16179-97-8
:2-Pyridylacetic acid hydrochloride
Description:
2-Pyridylacetic acid hydrochloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound is a derivative of pyridine and acetic acid, featuring a carboxylic acid functional group that contributes to its acidic properties. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it useful in various chemical applications. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility. 2-Pyridylacetic acid hydrochloride is often utilized in pharmaceutical research and synthesis, particularly in the development of biologically active compounds. Its unique structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit various biological activities, including potential anti-inflammatory or analgesic effects, although specific activities can vary based on the context of use. Proper handling and storage are essential due to its chemical nature.
Formula:C7H7NO2·ClH
InChI:InChI=1S/C7H7NO2.ClH/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10);1H
InChI key:InChIKey=MQVISALTZUNQSK-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=CC=N1.Cl
Synonyms:- 2-(Carboxymethyl)pyridin-1-ium chloride
- 2-(Pyridin-2-Yl)Acetic Acid Hydrochloride
- 2-Pyridine acetic acid hydrochloride
- 2-Pyridineacetic acid hydrochloride
- 2-Pyridineacetic acid, hydrochloride (1:1)
- 2-Pyridinylacetic acid hydrochloride
- 2-Pyridylacetic acid monohydrochloride
- 2-Pyridylacetic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Pyridylacetic Acid Hydrochloride
CAS:Formula:C7H7NO2·HClPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Dark green powder to crystalMolecular weight:173.602-Pyridineacetic acid, hydrochloride (1:1)
CAS:Formula:C7H8ClNO2Purity:95%Color and Shape:SolidMolecular weight:173.5969(Pyridin-2-yl)acetic acid hydrochloride
CAS:(Pyridin-2-yl)acetic acid hydrochlorideFormula:C7H7NO2·ClHPurity:≥95%Color and Shape: white to off white crystalline needlesMolecular weight:173.60g/mol2-Pyridylacetic Acid HCl
CAS:Formula:C7H7NO2·HClColor and Shape:White To Off-White SolidMolecular weight:137.14 36.462'-Pyridylacetic Acid Hydrochloride
CAS:Stability Hygroscopic
Applications Used in nucleophilic substitution.
References Genicot, C., et al.: Bioorg. Med. Chem. Lett., 13, 437 (2003),Formula:C7H7NO2·ClHColor and Shape:NeatMolecular weight:173.6Pyridin-2-ylacetic acid hydrochloride
CAS:Formula:C7H8ClNO2Purity:95%Color and Shape:Solid, Beige powderMolecular weight:173.6







