CAS 161790-23-4

2-(2-Fluorophenoxy)butanoic acid

Description:

2-(2-Fluorophenoxy)butanoic acid, with the CAS number 161790-23-4, is an organic compound characterized by its unique structure, which includes a butanoic acid moiety linked to a 2-fluorophenoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The fluorine atom in the phenoxy group can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. As a result, 2-(2-Fluorophenoxy)butanoic acid may be of interest in pharmaceutical research, particularly in the development of herbicides or other agrochemicals, due to its potential role in modulating plant growth or herbicidal activity. Additionally, its structural characteristics may allow for various synthetic modifications, making it a versatile compound in organic synthesis. However, specific applications and biological effects would require further investigation and validation through experimental studies.

Formula: C₁₀H₁₁FO₃

InChI: InChI=1S/C10H11FO3/c1-2-8(10(12)13)14-9-6-4-3-5-7(9)11/h3-6,8H,2H2,1H3,(H,12,13)

InChI key: InChIKey=DLYKJZCWTHWNBH-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)CC)C1=C(F)C=CC=C1

Synonyms:

• Butanoic acid, 2-(2-fluorophenoxy)-, (±)-
• Butanoic acid, 2-(2-fluorophenoxy)-
• 2-(2-Fluorophenoxy)butanoic acid

2-(2-Fluorophenoxy)butanoic acid

CAS: 161790-23-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁FO₃

Purity: Min. 95%

Molecular weight: 198.19 g/mol

Ref: 3D-LGA79023