CAS 16183-21-4

N-(4-Methylbenzyl)butan-1-amine

Description:

N-(4-Methylbenzyl)butan-1-amine, also known by its CAS number 16183-21-4, is an organic compound characterized by its amine functional group and a butyl chain. This substance features a butan-1-amine backbone, which is a straight-chain primary amine, and is substituted with a 4-methylbenzyl group, indicating the presence of a toluene derivative attached to the nitrogen atom. The molecular structure suggests that it may exhibit properties typical of both amines and aromatic compounds, such as basicity and potential hydrophobic interactions due to the aromatic ring. The presence of the methyl group on the benzyl moiety can influence its steric and electronic properties, potentially affecting its reactivity and solubility in various solvents. N-(4-Methylbenzyl)butan-1-amine may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₉N

InChI: InChI=1/C12H19N/c1-3-4-9-13-10-12-7-5-11(2)6-8-12/h5-8,13H,3-4,9-10H2,1-2H3

SMILES: CCCCNCc1ccc(C)cc1

Synonyms:

• benzenemethanamine, N-butyl-4-methyl-

N-(4-Methylbenzyl)butan-1-amine

CAS: 16183-21-4

Versatile small molecule scaffold

Formula: C₁₂H₁₉N

Purity: Min. 95%

Molecular weight: 177.29 g/mol

Ref: 3D-RAA18321