CAS 161886-60-8
:[(2S)-4-hydroxy-2-methylsulfonyloxy-4-oxo-butyl]-trimethyl-ammonium; methanesulfonate
Description:
The chemical substance known as "[(2S)-4-hydroxy-2-methylsulfonyloxy-4-oxo-butyl]-trimethyl-ammonium; methanesulfonate" with CAS number 161886-60-8 is a quaternary ammonium compound characterized by its complex structure, which includes a trimethylammonium group and a methanesulfonate counterion. This compound features a chiral center, indicated by the (2S) configuration, which contributes to its potential biological activity and specificity in interactions. The presence of a hydroxyl group and a sulfonyl moiety suggests that it may exhibit polar characteristics, enhancing its solubility in aqueous environments. Additionally, the oxo and methylsulfonyloxy functional groups may impart unique reactivity and stability properties. Such compounds are often investigated for their applications in pharmaceuticals, particularly as potential drug candidates or intermediates due to their ability to interact with biological systems. Overall, the structural features of this compound suggest it may have significant implications in medicinal chemistry and related fields.
Formula:C9H20NO8S2
InChI:InChI=1/C8H16NO5S.CH4O3S/c1-9(2,3)6-7(5-8(10)11)14-15(4,12)13;1-5(2,3)4/h7H,1,5-6H2,2-4H3;1H3,(H,2,3,4)/t7-;/m0./s1
SMILES:C=N(C)(C)C[C@H](CC(=O)O)OS(=O)(=O)C.CS(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-[(methylsulfonyl)oxy]-, (S)-, methanesulfonate (9CI)
CAS:Formula:C9H21NO8S2Color and Shape:SolidMolecular weight:335.3949(S)-Carnitine Mesylate, Mesylate Salt
CAS:Controlled ProductApplications (S)-Carnitine Mesylate, Mesylate Salt (cas# 161886-60-8) is a compound useful in organic synthesis.
Formula:C8H18NO5S·CH3O3SColor and Shape:NeatMolecular weight:335.39


