CAS 1619-13-2

8-methyl-5-(1-methylethyl)-9-methylideneoctahydro-1H-4,8-methanoisochromen-3-ol

Description:

The chemical substance known as 8-methyl-5-(1-methylethyl)-9-methylideneoctahydro-1H-4,8-methanoisochromen-3-ol, with the CAS number 1619-13-2, is a complex organic compound characterized by its unique bicyclic structure. It features multiple methyl groups and an isopropyl substituent, contributing to its hydrophobic nature. This compound is part of the larger class of terpenes and may exhibit various biological activities, including potential therapeutic properties. Its structure suggests it may interact with biological systems, possibly influencing pathways related to inflammation or cell signaling. The presence of hydroxyl groups indicates it may also engage in hydrogen bonding, affecting its solubility and reactivity. Additionally, due to its intricate stereochemistry, it may exhibit specific optical activity. Overall, this compound's characteristics make it of interest in fields such as medicinal chemistry and natural product research, where understanding its properties can lead to the development of new pharmaceuticals or agrochemicals.

Formula: C₁₅H₂₄O₂

InChI: InChI=1/C15H24O2/c1-8(2)10-5-6-15(4)9(3)12-13(10)11(15)7-17-14(12)16/h8,10-14,16H,3,5-7H2,1-2,4H3

Synonyms:

• 4,8-Methano-1H-2-benzopyran-3-ol, octahydro-8-methyl-9-methylene-5-(1-methylethyl)-

Prehelminthosporol

CAS: 1619-13-2

Prehelminthosporol is a phytotoxin aiding fungal growth by killing/weakening plant cells for nutrient uptake.

Formula: C₁₅H₂₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.35

Ref: TM-TN4822

Prehelminthosporol

CAS: 1619-13-2

Prehelminthosporol is a secondary metabolite produced by certain fungal species, particularly from the genus Helminthosporium. This chemical compound is derived from the biosynthetic processes of these fungi, where it is synthesized as part of their natural metabolic pathways. With its unique mode of action, prehelminthosporol disrupts essential cellular processes in other fungal organisms, leading to their inhibition or eventual eradication. Its antifungal activity is mediated through interference with fungal cell membrane integrity or enzyme functions, although specific mechanistic details continue to be an area of active research.

Formula: C₁₅H₂₄O₂

Purity: Min. 95%

Molecular weight: 236.35 g/mol

Ref: 3D-BAA61913