
CAS 1619264-50-4
:4-Piperidinemethanamine, 1-propyl-, hydrochloride (1:1)
Description:
4-Piperidinemethanamine, 1-propyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This substance features a propyl group attached to the piperidine nitrogen, contributing to its amine properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The compound may exhibit basicity due to the presence of the amine functional group, allowing it to participate in protonation reactions. Its molecular interactions can be influenced by the piperidine moiety, which can engage in hydrogen bonding and other non-covalent interactions. The compound's specific properties, such as melting point, boiling point, and reactivity, would depend on its purity and the conditions under which it is handled. As with many amines, it may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and usage guidelines.
Formula:C9H20N2·ClH
InChI:InChI=1S/C9H20N2.ClH/c1-2-5-11-6-3-9(8-10)4-7-11;/h9H,2-8,10H2,1H3;1H
InChI key:InChIKey=OSVHQUXUPTVHMW-UHFFFAOYSA-N
SMILES:C(CC)N1CCC(CN)CC1.Cl
Synonyms:- 4-Piperidinemethanamine, 1-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
