CAS 161950-10-3
:4-Chloro-M-Tolueneboronic acid
Description:
4-Chloro-M-tolueneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated aromatic ring. Its molecular structure features a toluene moiety, which consists of a methyl group attached to a benzene ring, with a chlorine substituent at the para position relative to the boronic acid group. This compound is typically used in organic synthesis, particularly in Suzuki coupling reactions, which are valuable for forming carbon-carbon bonds. The boronic acid functionality allows for the formation of stable complexes with diols, making it useful in various applications, including drug discovery and materials science. 4-Chloro-M-tolueneboronic acid is generally handled with care due to its potential reactivity and the presence of chlorine, which can impart specific environmental and safety considerations. It is important to note that, like many organoboron compounds, it may exhibit unique solubility and stability characteristics depending on the solvent and conditions used in reactions.
Formula:C7H8BClO2
InChI:InChI=1/C7H8BClO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4,10-11H,1H3
SMILES:Cc1ccc(c(c1)B(O)O)Cl
Synonyms:- 4-Chloro-3-Methylbenzeneboronic acid
- Akos Brn-0230
- 4-Chloro-3-Methylphenylboronic acid
- (2-Chloro-5-methylphenyl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-3-methylbenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H8BClO2Purity:98%Color and Shape:White, PowderMolecular weight:170.40Boronic acid, B-(4-chloro-3-methylphenyl)-
CAS:Formula:C7H8BClO2Purity:97%Color and Shape:SolidMolecular weight:170.40124-Chloro-3-methylbenzeneboronic acid
CAS:4-Chloro-3-methylbenzeneboronic acidFormula:C7H8BClO2Purity:≥95%Color and Shape: white powderMolecular weight:170.40g/mol4-Chloro-3-methylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BClO2Purity:97.0 to 112.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:170.404-Chloro-3-methylphenylboronic acid
CAS:Formula:C7H8BClO2Purity:98%Color and Shape:SolidMolecular weight:170.4




