CAS 161957-56-8
:3-Bromo-2-fluorobenzoic acid
Description:
3-Bromo-2-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on the benzene ring. Specifically, the bromine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the fluorine atom is at the ortho position (2-position). This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of halogen substituents can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique physical and chemical properties, such as altered melting and boiling points compared to its non-halogenated counterparts. Its molecular structure allows for potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable compound in synthetic organic chemistry.
Formula:C7H4BrFO2
InChI:InChI=1S/C7H4BrFO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11)
InChI key:InChIKey=UVKURTLVTLRSSM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(Br)=CC=C1
Synonyms:- 2,4-Dibromo-3,3,4,4-Tetrafluorobut-1-Ene
- 2-Fluoro-3-bromobenzoic acid
- 3-Bromo-2-fluorobenzenecarboxylic acid
- 3-Bromo-2-fluorobenzoic
- Benzoic acid, 3-bromo-2-fluoro-
- Buttpark 14\01-30
- 3-Bromo-2-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Bromo-2-fluorobenzoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H4BrFO2Purity:97%Color and Shape:Solid, Off-whiteMolecular weight:219.01Benzoic acid, 3-bromo-2-fluoro-
CAS:Formula:C7H4BrFO2Purity:98%Color and Shape:SolidMolecular weight:219.00793-Bromo-2-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:219.013-Bromo-2-fluorobenzoic acid
CAS:3-Bromo-2-fluorobenzoic acidFormula:C7H4BrFO2Purity:97%Color and Shape: pale yellow solidMolecular weight:219.01g/mol3-Bromo-2-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:95%Color and Shape:SolidMolecular weight:219.0093-Bromo-2-fluorobenzoic acid
CAS:3-Bromo-2-fluorobenzoic acid is a molecule that can be activated to react with substituents. It has been used in research in the synthesis of fluorine-containing compounds and substituted benzenes, as well as in the preparation of heterocycles. 3-Bromo-2-fluorobenzoic acid can be synthesized by the reaction of butyllithium with bromobenzene. The synthesis of this compound has been described in detail for educational purposes.Formula:C7H4BrFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:219.01 g/mol






