CAS 161957-62-6

1-(3-Bromo-2-chlorophenyl)ethanone

Description:

1-(3-Bromo-2-chlorophenyl)ethanone, with the CAS number 161957-62-6, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of both bromine and chlorine atoms on the phenyl ring contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its moderate to high polarity due to the electronegative halogen substituents. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's unique halogen substituents can influence its physical properties, such as melting and boiling points, as well as its solubility in different solvents. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health and environmental risks.

Formula: C₈H₆BrClO

InChI: InChI=1S/C8H6BrClO/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3

InChI key: InChIKey=XNQYDIUKOZQSOM-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(Cl)C(Br)=CC=C1

Synonyms:

• Ethanone, 1-(3-bromo-2-chlorophenyl)-
• 1-(3-Bromo-2-chlorophenyl)ethanone
• 1-(3-Bromo-2-chlorophenyl)ethan-1-one

Ethanone, 1-(3-bromo-2-chlorophenyl)-

CAS: 161957-62-6

Formula: C₈H₆BrClO

Purity: 96%

Color and Shape: Liquid

Molecular weight: 233.4896

Ref: IN-DA001SJZ

1-(3-Bromo-2-chlorophenyl)ethanone

CAS: 161957-62-6

1-(3-Bromo-2-chlorophenyl)ethanone

Purity: 98%

Molecular weight: 233.49g/mol

Ref: 54-OR52398

1-(3-Bromo-2-chlorophenyl)ethanone

CAS: 161957-62-6

Formula: C₈H₆BrClO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 233.49

Ref: 10-F334216