CAS 16196-83-1

Ethanone, 1-[(5α,7β)-4,5-epoxy-18,19-dihydro-3,6-dimethoxy-17-methyl-6,14-ethenomorphinan-7-yl]-

Description:

Ethanone, 1-[(5α,7β)-4,5-epoxy-18,19-dihydro-3,6-dimethoxy-17-methyl-6,14-ethenomorphinan-7-yl]- (CAS 16196-83-1) is a synthetic organic compound belonging to the class of morphinans, which are derivatives of morphine. This compound features a complex structure characterized by an epoxy group, multiple methoxy substituents, and a unique morphinan backbone. Its molecular structure contributes to its potential biological activity, particularly in relation to opioid receptors, which may influence its pharmacological properties. The presence of the ethanone functional group indicates that it may participate in various chemical reactions typical of ketones, such as nucleophilic additions. Additionally, the stereochemistry of the compound, denoted by the specific alpha and beta configurations, plays a crucial role in its interaction with biological systems. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, particularly in the development of analgesics or other therapeutic agents. However, detailed studies would be necessary to fully understand its properties and effects.

Formula: C₂₃H₂₉NO₄

InChI: InChI=1S/C23H29NO4/c1-13(25)15-12-21-7-8-23(15,27-4)20-22(21)9-10-24(2)17(21)11-14-5-6-16(26-3)19(28-20)18(14)22/h5-6,15,17,20H,7-12H2,1-4H3/t15-,17+,20+,21+,22-,23+/m0/s1

InChI key: InChIKey=KRWAWNXEYPCCLG-WKUBJUINSA-N

SMILES: O(C)[C@@]12[C@]3([C@@]45[C@@]([C@@](CC6=C4C(O3)=C(OC)C=C6)(N(C)CC5)[H])(C[C@H]1C(C)=O)CC2)[H]

Synonyms:

• 6,14-Ethenomorphinan, ethanone deriv.
• 6,14-endo-Ethanotetrahydrothebaine, 7β-acetyl-
• β-Dihydrothevinone
• Ethanone, 1-[(5α,7β)-4,5-epoxy-18,19-dihydro-3,6-dimethoxy-17-methyl-6,14-ethenomorphinan-7-yl]-

Beta-Dihydrothevinone

Controlled Product

CAS: 16196-83-1

Applications β-Dihydrothevinone is an intermediate in synthesizing 7-(S)-Buprenorphine (B689765), which is a controlled substance (narcotic). Analgesic that demonstrates narcotic agonist-antagonist properties.
References Martin, W.R., et al.: J. Pharmacol. Exp. Ther., 197, 517 (1976); Rance, M.J., Biochem. Pharmacol., 25, 735 (1976); Heel, R.C., et al.: Drugs, 17, 81 (1979);

Formula: C₂₃H₂₉NO₄

Color and Shape: Neat

Molecular weight: 383.48

Ref: TR-D449843

b-Dihydrothevinone

CAS: 16196-83-1

Formula: C₂₃H₂₉NO₄

Ref: TR-TRC-D449843