CAS 161972-10-7

(3S)-3,4-Dihydroxy-2-butanone

Description:

(3S)-3,4-Dihydroxy-2-butanone, with the CAS number 161972-10-7, is an organic compound characterized by its two hydroxyl (-OH) groups and a ketone functional group. This compound is a stereoisomer, specifically the S-enantiomer, which indicates its specific three-dimensional arrangement of atoms. It is a colorless to pale yellow liquid that is soluble in water due to the presence of hydroxyl groups, which can form hydrogen bonds with water molecules. The compound is typically used in biochemical research and may play a role in metabolic pathways. Its structure allows it to participate in various chemical reactions, including oxidation and reduction processes. Additionally, the presence of multiple functional groups suggests potential reactivity with other organic compounds, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₄H₈O₃

InChI: InChI=1S/C4H8O3/c1-3(6)4(7)2-5/h4-5,7H,2H2,1H3/t4-/m0/s1

InChI key: InChIKey=SEYLPRWNVFCVRQ-BYPYZUCNSA-N

SMILES: [C@@H](C(C)=O)(CO)O

Synonyms:

• 2-Butanone, 3,4-dihydroxy-, (S)-
• 2-Butanone, 3,4-dihydroxy-, (3S)-
• (3S)-3,4-Dihydroxybutan-2-one
• (3S)-3,4-Dihydroxy-2-butanone
• 1-Deoxy-L-erythrulose

1-Deoxy-L-erythrulose

CAS: 161972-10-7

1-Deoxy-L-erythrulose is an electron acceptor that is a non-essential cofactor for the enzyme reductoisomerase. It binds to the active site of the enzyme and stabilizes its conformation, which leads to the formation of a dianion. 1-Deoxy-L-erythrulose also acts as an activator for phosphite, which is a transition state analog. This activation leads to the formation of ATP and NADPH as products.

Formula: C₄H₈O₃

Purity: Min. 95%

Molecular weight: 104.1 g/mol

Ref: 3D-MD177470