CAS 161975-39-9
:1-Boc-4-Methanesulfonyloxymethyl-Piperidine
Description:
1-Boc-4-Methanesulfonyloxymethyl-Piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for amines, enhancing the compound's stability and reactivity in various chemical reactions. The presence of the methanesulfonyloxymethyl group indicates that the compound has a methanesulfonyl functional group, which can act as a leaving group in nucleophilic substitution reactions. This compound is typically used in organic synthesis, particularly in the preparation of more complex molecules, due to its ability to undergo various transformations. Its structure suggests potential applications in medicinal chemistry, especially in the development of pharmaceuticals. The compound's solubility, reactivity, and stability can be influenced by the functional groups attached to the piperidine ring, making it a versatile intermediate in synthetic pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with its reactivity and toxicity.
Formula:C12H23NO5S
InChI:InChI=1/C12H23NO5S/c1-12(2,3)18-11(14)13-7-5-10(6-8-13)9-17-19(4,15)16/h10H,5-9H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)COS(=O)(=O)C
Synonyms:- Tert-Butyl 4-([(Methylsulfonyl)Oxy]Methyl)Tetrahydro-1(2H)-Pyridinecarboxylate
- 1-N-Boc-4-Methanesulfonyloxymethylpiperidine
- Tert-Butyl 4-{[(Methylsulfonyl)Oxy]Methyl}Piperidine-1-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl 4-([(methylsulfonyl)oxy]methyl)tetrahydro-1(2h)-pyridinecarboxylate
CAS:Formula:C12H23NO5SPurity:95%Color and Shape:SolidMolecular weight:293.3797tert-Butyl 4-(((methylsulfonyl)oxy)methyl)piperidine-1-carboxylate
CAS:tert-Butyl 4-(((methylsulfonyl)oxy)methyl)piperidine-1-carboxylatePurity:99%Molecular weight:293.39g/moltert-Butyl 4-[[(Methylsulfonyl)oxy]methyl]piperidine-1-carboxylate
CAS:Formula:C12H23NO5SPurity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:293.38tert-Butyl 4-(((methylsulfonyl)oxy)methyl)piperidine-1-carboxylate
CAS:Formula:C12H23NO5SPurity:95%Color and Shape:SolidMolecular weight:293.38tert-Butyl 4-{[(methylsulfonyl)oxy]methyl}piperidine-1-carboxylate
CAS:Please enquire for more information about tert-Butyl 4-{[(methylsulfonyl)oxy]methyl}piperidine-1-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H23NO5SPurity:Min. 95%Molecular weight:293.38 g/mol




