CAS 1620-53-7
:1-Phenyl-2-(2-pyridinyl)ethanone
Description:
1-Phenyl-2-(2-pyridinyl)ethanone, also known as 2-(2-Pyridyl)acetophenone, is an organic compound characterized by its ketone functional group and the presence of both phenyl and pyridine rings. It typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. The compound has a molecular formula that reflects its structure, consisting of a phenyl group attached to an acetyl group, which is further substituted with a pyridine ring. This structure contributes to its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The compound is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. Its reactivity is influenced by the electron-withdrawing nature of the pyridine ring, which can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid inhalation or skin contact.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14-12/h1-9H,10H2
InChI key:InChIKey=CMOXTMGJZNCXEI-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=N1)(=O)C2=CC=CC=C2
Synonyms:- 2-(Benzoylmethyl)pyridine
- α-Pyridylacetophenone
- 1-phenyl-2-(pyridin-2-yl)ethanone
- Ethanone, 1-phenyl-2-(2-pyridinyl)-
- Acetophenone, 2-(2-pyridyl)-
- 1-Phenyl-2-(2-pyridinyl)ethanone
- 1-Phenyl-2-(pyridin-2-yl)ethan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethanone, 1-phenyl-2-(2-pyridinyl)-
CAS:Formula:C13H11NOPurity:97%Color and Shape:SolidMolecular weight:197.23251-Phenyl-2-(2-pyridinyl)-ethanone
CAS:<p>1-Phenyl-2-(2-pyridinyl)-ethanone is a hydrogen bond donor and an enolate anion. It has tautomeric and zwitterionic properties. The protonation of the methyl ketones in 1-phenyl-2-(2-pyridinyl)ethanone will lead to the formation of the enolate anion, which can act as a proton acceptor. The intramolecular hydrogen bonding in 1-phenyl-2-(2-pyridinyl)-ethanone leads to its tautomeric properties, because it can exist as both the keto form or enol form. When 1-phenyl-2-(2-pyridinyl)ethanone is deprotonated, it forms a carbonyl group that acts as an acceptor for hydrogen bonding with other molecules.</p>Formula:C13H11NOPurity:Min. 95%Molecular weight:197.23 g/mol

