CymitQuimica logo

CAS 1620056-83-8

:

(3bS,4aR)-5,5-Difluoro-3b,4,4a,5-tetrahydro-3-(trifluoromethyl)-1H-cyclopropa[3,4]cyclopenta[1,2-c]pyrazole-1-acetic acid

Description:
The chemical substance known as "(3bS,4aR)-5,5-Difluoro-3b,4,4a,5-tetrahydro-3-(trifluoromethyl)-1H-cyclopropa[3,4]cyclopenta[1,2-c]pyrazole-1-acetic acid" with CAS number 1620056-83-8 is a complex organic compound characterized by its unique bicyclic structure, which incorporates both cyclopropane and pyrazole moieties. The presence of multiple fluorine atoms, specifically two difluoro groups and a trifluoromethyl group, contributes to its distinctive chemical properties, including increased lipophilicity and potential biological activity. The stereochemistry indicated by the (3bS,4aR) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its acetic acid functional group suggests potential for solubility in polar solvents, which is relevant for formulation in pharmaceutical applications. Overall, the intricate structure and functional groups of this compound position it as a subject of interest in both synthetic and medicinal chemistry.
Formula:C10H7F5N2O2
InChI:InChI=1S/C10H7F5N2O2/c11-9(12)4-1-3(4)6-7(10(13,14)15)16-17(8(6)9)2-5(18)19/h3-4H,1-2H2,(H,18,19)/t3-,4+/m0/s1
InChI key:InChIKey=KKEFPICWHXMILG-IUYQGCFVSA-N
SMILES:C(C(O)=O)N1C2=C([C@@]3([C@](C2(F)F)(C3)[H])[H])C(C(F)(F)F)=N1
Synonyms:
  • (3bS,4aR)-5,5-Difluoro-3b,4,4a,5-tetrahydro-3-(trifluoromethyl)-1H-cyclopropa[3,4]cyclopenta[1,2-c]pyrazole-1-acetic acid
  • 1H-Cyclopropa[3,4]cyclopenta[1,2-c]pyrazole-1-acetic acid, 5,5-difluoro-3b,4,4a,5-tetrahydro-3-(trifluoromethyl)-, (3bS,4aR)-
Found 6 products.