CymitQuimica logo

CAS 1620097-07-5

:

[(7R)-Hexahydro-7-methyl-4-(phenylmethyl)-1H-1,4-diazepin-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]methanone

Description:
The chemical substance with the name "[(7R)-Hexahydro-7-methyl-4-(phenylmethyl)-1H-1,4-diazepin-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]methanone" and CAS number "1620097-07-5" is a complex organic compound characterized by its unique structural features, including a hexahydro-diazepine ring and a triazole moiety. This compound likely exhibits properties typical of heterocyclic compounds, such as potential biological activity due to the presence of nitrogen-containing rings. The presence of multiple functional groups suggests it may engage in various chemical interactions, making it of interest in medicinal chemistry and drug development. Its stereochemistry, indicated by the (7R) configuration, implies specific spatial arrangements that could influence its pharmacological properties. Additionally, the compound's molecular weight, solubility, and stability would depend on its specific functional groups and overall structure, which are critical for understanding its behavior in biological systems and potential applications in therapeutics. Further studies would be necessary to elucidate its complete profile, including its reactivity and biological activity.
Formula:C23H27N5O
InChI:InChI=1S/C23H27N5O/c1-18-8-9-22(28-24-11-12-25-28)21(16-18)23(29)27-15-14-26(13-10-19(27)2)17-20-6-4-3-5-7-20/h3-9,11-12,16,19H,10,13-15,17H2,1-2H3/t19-/m1/s1
InChI key:InChIKey=DRWURUAZLCYLTK-LJQANCHMSA-N
SMILES:C(=O)(C1=C(C=CC(C)=C1)N2N=CC=N2)N3CCN(CC4=CC=CC=C4)CC[C@H]3C
Synonyms:
  • [(7R)-Hexahydro-7-methyl-4-(phenylmethyl)-1H-1,4-diazepin-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]methanone
  • Methanone, [(7R)-hexahydro-7-methyl-4-(phenylmethyl)-1H-1,4-diazepin-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.