CymitQuimica logo

CAS 162011-83-8

:

MF-tricyclic

Description:
MF-tricyclic, with the CAS number 162011-83-8, is a chemical compound that belongs to the class of tricyclic compounds, which are characterized by their three interconnected aromatic rings. This structure often imparts unique chemical properties, including stability and the ability to engage in various chemical reactions. MF-tricyclic is primarily recognized for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure may influence its pharmacokinetics and pharmacodynamics, making it a subject of interest in drug design. The compound may exhibit specific biological activities, potentially interacting with various biological targets, which can lead to therapeutic effects. Additionally, tricyclic compounds often display lipophilicity, affecting their solubility and absorption in biological systems. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, MF-tricyclic exemplifies the complexity and utility of tricyclic structures in chemical and pharmaceutical research.
Formula:C17H12F2O4S
InChI:InChI=1S/C17H12F2O4S/c1-24(21,22)12-5-2-10(3-6-12)13-9-23-17(20)16(13)11-4-7-14(18)15(19)8-11/h2-8H,9H2,1H3
InChI key:InChIKey=INRQTVDUZFESAO-UHFFFAOYSA-N
SMILES:O=C1C(=C(CO1)C2=CC=C(S(C)(=O)=O)C=C2)C3=CC(F)=C(F)C=C3
Synonyms:
  • 2(5H)-Furanone, 3-(3,4-difluorophenyl)-4-(4-(methylsulfonyl)phenyl)-
  • 3-(3,4-difluorophenyl)-4-[4-(methylsulfonyl)phenyl]furan-2(5H)-one
  • MF Tricyclic
  • 3-(3,4-Difluorophenyl)-4-[4-(methylsulfonyl)phenyl]-2(5H)-furanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.