CAS 162012-70-6

4-CHLORO-7-FLUORO-6-NITRO-QUINAZOLINE

Description:

4-Chloro-7-fluoro-6-nitro-quinazoline is a heterocyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. The presence of chlorine, fluorine, and nitro substituents at specific positions on the quinazoline ring significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of the nitro group, which can participate in various chemical reactions. Additionally, the halogen substituents (chlorine and fluorine) can enhance the lipophilicity and metabolic stability of the compound, making it a candidate for pharmaceutical applications. Safety data should be consulted, as halogenated compounds can sometimes exhibit toxicity or environmental concerns. Overall, 4-chloro-7-fluoro-6-nitro-quinazoline represents a class of compounds with diverse applications in medicinal chemistry and material science.

Formula: C₈H₃ClFN₃O₂

InChI: InChI=1/C8H3ClFN3O2/c9-8-4-1-7(13(14)15)5(10)2-6(4)11-3-12-8/h1-3H

SMILES: c1c2c(cc(c1N(=O)=O)F)ncnc2Cl

Synonyms:

• 4-Chloro-7-Fluoro-6-Nitroquinazoline
• Quinazoline, 4-Chloro-7-Fluoro-6-Nitro-

Quinazoline, 4-chloro-7-fluoro-6-nitro-

CAS: 162012-70-6

Formula: C₈H₃ClFN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.5797

Ref: IN-DA001SMM

4-Chloro-7-fluoro-6-nitroquinazoline

CAS: 162012-70-6

4-Chloro-7-fluoro-6-nitroquinazoline

Purity: 98%

Molecular weight: 227.58g/mol

Ref: 54-PC100329

Afatinib Impurity 24

CAS: 162012-70-6

Formula: C₈H₃ClFN₃O₂

Molecular weight: 227.58

Ref: 4Z-A-111039

4-Chloro-7-fluoro-6-nitroquinazoline

CAS: 162012-70-6

Formula: C₈H₃ClFN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.58

Ref: 10-F221597

4-Chloro-7-fluoro-6-nitroquinazoline

Controlled Product

CAS: 162012-70-6

Formula: C₈H₃ClFN₃O₂

Color and Shape: Neat

Molecular weight: 227.58

Ref: TR-C376255