CAS 162012-71-7
:4,7-Dichloro-6-nitroquinazoline
Description:
4,7-Dichloro-6-nitroquinazoline is a synthetic organic compound characterized by its quinazoline core, which is a bicyclic structure containing both benzene and pyrimidine rings. This compound features two chlorine atoms and a nitro group, which contribute to its chemical reactivity and potential applications. The presence of the dichloro substituents at the 4 and 7 positions, along with the nitro group at the 6 position, enhances its electrophilic properties, making it useful in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Due to its structural features, 4,7-Dichloro-6-nitroquinazoline may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, handling this compound requires caution due to the potential toxicity associated with chlorine and nitro groups. As with any chemical substance, proper safety protocols should be followed during its use and disposal.
Formula:C8H3Cl2N3O2
InChI:InChI=1S/C8H3Cl2N3O2/c9-5-2-6-4(1-7(5)13(14)15)8(10)12-3-11-6/h1-3H
InChI key:InChIKey=VHFFODQAQLNACY-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(Cl)C(N(=O)=O)=C2)N=CN1
Synonyms:- 4,7-Dichloro-6-nitroquinazoline
- Quinazoline, 4,7-dichloro-6-nitro-
- 4,7-Dichloro-6-nitroquinazoline Canertinib int
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
