CAS 162045-53-6
:tert-butyl 4-(2-oxo-1,3-benzoxazol-3(2H)-yl)piperidine-1-carboxylate
Description:
Tert-butyl 4-(2-oxo-1,3-benzoxazol-3(2H)-yl)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a tert-butyl ester group, and a benzoxazole moiety. This compound typically exhibits properties associated with both its piperidine and benzoxazole components, such as potential biological activity and solubility in organic solvents. The presence of the tert-butyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The benzoxazole ring is known for its role in various biological activities, including antimicrobial and anticancer properties. Additionally, the compound may participate in hydrogen bonding and π-π stacking interactions due to its aromatic nature, which can affect its reactivity and interactions with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C17H22N2O4
InChI:InChI=1/C17H22N2O4/c1-17(2,3)23-15(20)18-10-8-12(9-11-18)19-13-6-4-5-7-14(13)22-16(19)21/h4-7,12H,8-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)n1c2ccccc2oc1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(2-oxobenzo[d]oxazol-3(2H)-yl)piperidine-1-carboxylate
CAS:Formula:C17H22N2O4Molecular weight:318.3676
