CAS 162046-59-5

2-Chloro-4-(chloromethyl)-6-methylpyridine

Description:

2-Chloro-4-(chloromethyl)-6-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine and methyl groups. The presence of the chlorine atoms introduces significant reactivity, making it a potential intermediate in various chemical syntheses. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents, which enhances its utility in organic synthesis. The molecular structure features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for forming coordination complexes. The chloromethyl group can participate in nucleophilic substitution reactions, while the methyl group can influence the compound's steric and electronic properties. Safety considerations are essential when handling this compound, as it may pose health risks due to its chlorinated nature. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use in laboratory or industrial settings.

Formula: C₇H₇Cl₂N

InChI: InChI=1S/C7H7Cl2N/c1-5-2-6(4-8)3-7(9)10-5/h2-3H,4H2,1H3

InChI key: InChIKey=JNYFUZZTJPBDPC-UHFFFAOYSA-N

SMILES: C(Cl)C=1C=C(C)N=C(Cl)C1

Synonyms:

• Pyridine, 2-chloro-4-(chloromethyl)-6-methyl-
• 2-Chloro-4-(chloromethyl)-6-methylpyridine

2-Chloro-4-(chloromethyl)-6-methylpyridine

CAS: 162046-59-5

Formula: C₇H₇Cl₂N

Molecular weight: 176.0432

Ref: IN-DA001SO2

2-Chloro-4-(chloromethyl)-6-methylpyridine

CAS: 162046-59-5

Versatile small molecule scaffold

Formula: C₇H₇NCl₂

Purity: Min. 95%

Molecular weight: 176.04 g/mol

Ref: 3D-MGA04659