CAS 1620482-41-8
:5-(2-Bromo-4-fluorophenoxy)-2,4-pyrimidinediamine
Description:
5-(2-Bromo-4-fluorophenoxy)-2,4-pyrimidinediamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with amino groups and a phenoxy group that contains both bromine and fluorine substituents. This compound is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in the pyrimidine ring. The bromine and fluorine atoms contribute to its reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the phenoxy group may enhance its lipophilicity, influencing its pharmacokinetic properties. Additionally, the compound may exhibit specific interactions with biological targets, which could be relevant for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to various analytical methods such as NMR, mass spectrometry, and chromatography for purity and structural confirmation. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research.
Formula:C10H8BrFN4O
InChI:InChI=1S/C10H8BrFN4O/c11-6-3-5(12)1-2-7(6)17-8-4-15-10(14)16-9(8)13/h1-4H,(H4,13,14,15,16)
InChI key:InChIKey=ITZRFJOYIBVJFT-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(F)C=C1)C=2C(N)=NC(N)=NC2
Synonyms:- 2,4-Pyrimidinediamine, 5-(2-bromo-4-fluorophenoxy)-
- 5-(2-Bromo-4-fluorophenoxy)-2,4-pyrimidinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(2-Bromo-4-fluorophenoxy)pyrimidine-2,4-diamine
CAS:5-(2-Bromo-4-fluorophenoxy)pyrimidine-2,4-diamine
Molecular weight:299.10g/mol
