CAS 16205-46-2

Pyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:

Pyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by a fused pyrazole and pyridine ring system. It features a carboxylic acid functional group at the 3-position of the pyrazolo ring, which contributes to its acidic properties. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. Pyrazolo[1,5-a]pyridine derivatives are of interest in medicinal chemistry for their potential biological activities, including anti-inflammatory and antitumor properties. The compound's structure allows for various chemical modifications, which can enhance its pharmacological profile. Additionally, it may participate in various chemical reactions, such as esterification and amidation, due to the reactive carboxylic acid group. Overall, Pyrazolo[1,5-a]pyridine-3-carboxylic acid is a versatile compound with significant implications in research and drug development.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c11-8(12)6-5-9-10-4-2-1-3-7(6)10/h1-5H,(H,11,12)

InChI key: InChIKey=HRSDPDBQVZHCRC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)C=CC=C2

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-carboxylic acid

Pyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 16205-46-2

Formula: C₈H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA001SP3

Pyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 16205-46-2

Pyrazolo[1,5-a]pyridine-3-carboxylic acid

Purity: 97%

Color and Shape: Solid

Molecular weight: 162.14543g/mol

Ref: 54-OR308077

Pyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 16205-46-2

Formula: C₈H₆N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.148

Ref: 10-F214752