CymitQuimica logo

CAS 162100-57-4

:

5-Chloro-2,3-dihydro-6-methyl-1H-indole

Description:
5-Chloro-2,3-dihydro-6-methyl-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular indole derivative features a chlorine atom at the 5-position and a methyl group at the 6-position, contributing to its unique reactivity and properties. The presence of the chlorine substituent can influence the compound's polarity, solubility, and potential interactions in biological systems. As a dihydro derivative, it possesses a saturated bond in the 2,3-position, which can affect its stability and reactivity compared to fully unsaturated indoles. This compound may exhibit interesting pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to the development of new derivatives with enhanced biological properties. Overall, 5-Chloro-2,3-dihydro-6-methyl-1H-indole is a versatile compound with potential applications in research and drug development.
Formula:C9H10ClN
InChI:InChI=1S/C9H10ClN/c1-6-4-9-7(2-3-11-9)5-8(6)10/h4-5,11H,2-3H2,1H3
InChI key:InChIKey=WOISWFMWUILFBW-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1C)NCC2
Synonyms:
  • 1H-Indole, 5-chloro-2,3-dihydro-6-methyl-
  • 5-Chloro-6-methylindoline
  • 5-Chloro-2,3-dihydro-6-methyl-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.