CAS 162101-31-7
:2-Fluoro-4-methoxybenzeneboronic acid
Description:
2-Fluoro-4-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that also features a fluorine atom and a methoxy group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, which is a common trait for boronic acids due to their ability to form hydrogen bonds. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity in various chemical reactions, including Suzuki coupling reactions, which are widely used in organic synthesis. The methoxy group contributes to the compound's overall hydrophobic character while also participating in hydrogen bonding interactions. Additionally, 2-Fluoro-4-methoxybenzeneboronic acid can serve as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, making it of significant interest in medicinal chemistry and materials science. Its reactivity and functionalization potential are key characteristics that facilitate its application in diverse chemical processes.
Formula:C7H8BFO3
InChI:InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3
SMILES:COc1ccc(c(c1)F)B(O)O
Synonyms:- 2-Fluoro-4-methoxyphenylboronic acid
- Fluoro-4-methoxyphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-4-methoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BFO3Color and Shape:White to Orange to Green powder to crystalMolecular weight:169.952-Fluoro-4-methoxybenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H8BFO3Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:169.95Boronic acid, B-(2-fluoro-4-methoxyphenyl)-
CAS:Formula:C7H8BFO3Purity:96%Color and Shape:SolidMolecular weight:169.94602-Fluoro-4-methoxybenzeneboronic acid
CAS:2-Fluoro-4-methoxybenzeneboronic acidFormula:C7H8BFO3Purity:≥95%Color and Shape: off white powderMolecular weight:169.95g/mol2-Fluoro-4-methoxyphenylboronic acid
CAS:Formula:C7H8BFO3Purity:96%Color and Shape:SolidMolecular weight:169.95




